About ethylurea
ethylurea (PubChem CID 12254) has the molecular formula C3H8N2O
and a molecular weight of 88.11 g/mol. Its IUPAC name is ethylurea.
Molecular Properties
| Compound Name | ethylurea |
| PubChem CID | 12254 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.06 |
| IUPAC Name | ethylurea |
| SMILES | CCNC(N)=O |
| InChI | InChI=1S/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
| InChIKey | RYECOJGRJDOGPP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylurea?
The IUPAC name of ethylurea (CID 12254) is ethylurea.
What is the SMILES notation for ethylurea?
The canonical SMILES for ethylurea is CCNC(N)=O.
What is the InChIKey of ethylurea?
The InChIKey is RYECOJGRJDOGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6).
What are the key properties of ethylurea?
ethylurea has a molecular weight of 88.11 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylurea is sourced from PubChem (CID 12254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).