C24H22F2N4O2 — CID 122540205
3-[2-(difluoromethoxy)-5-methylphenyl]-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 122540205) has the molecular formula C24H22F2N4O2 and a molecular weight of 436.46 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)-5-methylphenyl]-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 3-[2-(difluoromethoxy)-5-methylphenyl]-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 122540205 |
| Molecular Formula | C24H22F2N4O2 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[2-(difluoromethoxy)-5-methylphenyl]-12-(6-methoxy-3-pyridinyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | COc1ccc(-c2ccc3nc4c(n3c2)N(c2cc(C)ccc2OC(F)F)CCC4)cn1 |
| InChI | InChI=1S/C24H22F2N4O2/c1-15-5-8-20(32-24(25)26)19(12-15)29-11-3-4-18-23(29)30-14-17(6-9-21(30)28-18)16-7-10-22(31-2)27-13-16/h5-10,12-14,24H,3-4,11H2,1-2H3 |
| InChIKey | OBNJCHVJXDESNR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |