C27H25N5O — CID 122540220
2-[4-[3-(2,5-dimethylphenyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]phenyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 122540220) has the molecular formula C27H25N5O and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[4-[3-(2,5-dimethylphenyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]phenyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-[3-(2,5-dimethylphenyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]phenyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 122540220 |
| Molecular Formula | C27H25N5O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-[4-[3-(2,5-dimethylphenyl)-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]phenyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1ccc(C)c(N2CCCc3nc4ccc(-c5ccc(-c6nnc(C)o6)cc5)cn4c32)c1 |
| InChI | InChI=1S/C27H25N5O/c1-17-6-7-18(2)24(15-17)31-14-4-5-23-27(31)32-16-22(12-13-25(32)28-23)20-8-10-21(11-9-20)26-30-29-19(3)33-26/h6-13,15-16H,4-5,14H2,1-3H3 |
| InChIKey | RAZXTCKOFLVXEW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |