C26H26F2N6O2 — CID 122540243
4-[5-[3-[2-(difluoromethoxy)-5-methylphenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-yl]morpholine (PubChem CID 122540243) has the molecular formula C26H26F2N6O2 and a molecular weight of 492.53 g/mol. Its IUPAC name is 4-[5-[3-[2-(difluoromethoxy)-5-methylphenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-[3-[2-(difluoromethoxy)-5-methylphenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 122540243 |
| Molecular Formula | C26H26F2N6O2 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-[5-[3-[2-(difluoromethoxy)-5-methylphenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-yl]morpholine |
| SMILES | Cc1ccc(OC(F)F)c(N2CCCc3nc4ccc(-c5cnc(N6CCOCC6)nc5)cn4c32)c1 |
| InChI | InChI=1S/C26H26F2N6O2/c1-17-4-6-22(36-25(27)28)21(13-17)33-8-2-3-20-24(33)34-16-18(5-7-23(34)31-20)19-14-29-26(30-15-19)32-9-11-35-12-10-32/h4-7,13-16,25H,2-3,8-12H2,1H3 |
| InChIKey | CMRXGVMEQDEAGO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |