C23H19F3N4O2 — CID 122540259
12-(6-methoxy-3-pyridinyl)-3-[2-(trifluoromethoxy)phenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 122540259) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 12-(6-methoxy-3-pyridinyl)-3-[2-(trifluoromethoxy)phenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 12-(6-methoxy-3-pyridinyl)-3-[2-(trifluoromethoxy)phenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 122540259 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 12-(6-methoxy-3-pyridinyl)-3-[2-(trifluoromethoxy)phenyl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | COc1ccc(-c2ccc3nc4c(n3c2)N(c2ccccc2OC(F)(F)F)CCC4)cn1 |
| InChI | InChI=1S/C23H19F3N4O2/c1-31-21-11-9-15(13-27-21)16-8-10-20-28-17-5-4-12-29(22(17)30(20)14-16)18-6-2-3-7-19(18)32-23(24,25)26/h2-3,6-11,13-14H,4-5,12H2,1H3 |
| InChIKey | BPKHFMRIEPPQHW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |