C16H14FN5O — CID 122540369
3-fluoro-4-[7-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]benzonitrile (PubChem CID 122540369) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-fluoro-4-[7-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[7-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 122540369 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-fluoro-4-[7-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]benzonitrile |
| SMILES | COCCNc1cc(-c2ccc(C#N)cc2F)n2ncnc2c1 |
| InChI | InChI=1S/C16H14FN5O/c1-23-5-4-19-12-7-15(22-16(8-12)20-10-21-22)13-3-2-11(9-18)6-14(13)17/h2-3,6-8,10,19H,4-5H2,1H3 |
| InChIKey | DYBVVKHTQNXUPV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|