C12H7Cl2N3 — CID 122540625
5-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 122540625) has the molecular formula C12H7Cl2N3 and a molecular weight of 264.12 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 122540625 |
| Molecular Formula | C12H7Cl2N3 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Clc1ccc(-c2cccc3ncnn23)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl2N3/c13-8-4-5-9(10(14)6-8)11-2-1-3-12-15-7-16-17(11)12/h1-7H |
| InChIKey | BHYCFRGXFQGMDR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |