C23H42N6O5 — CID 122541119
(2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(3S)-3-azidobutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanamide (PubChem CID 122541119) has the molecular formula C23H42N6O5 and a molecular weight of 482.63 g/mol. Its IUPAC name is (2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(3S)-3-azidobutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanamide.
| Compound Name | (2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(3S)-3-azidobutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 122541119 |
| Molecular Formula | C23H42N6O5 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(3S)-3-azidobutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanamide |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N)=O)OC)N(C)C(=O)C[C@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C23H42N6O5/c1-8-14(2)21(28(5)19(30)12-15(3)26-27-25)18(33-6)13-20(31)29-11-9-10-17(29)22(34-7)16(4)23(24)32/h14-18,21-22H,8-13H2,1-7H3,(H2,24,32)/t14-,15-,16+,17-,18+,21-,22+/m0/s1 |
| InChIKey | SZGAZKACPRMEOE-BWNLUOLLSA-N |
| XLogP | 2.48 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|