C23H40N6O6 — CID 122541392
butyl (2S)-2-[[(1S)-3-amino-3-oxo-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-butoxybutanoate (PubChem CID 122541392) has the molecular formula C23H40N6O6 and a molecular weight of 496.61 g/mol. Its IUPAC name is butyl (2S)-2-[[(1S)-3-amino-3-oxo-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-butoxybutanoate.
| Compound Name | butyl (2S)-2-[[(1S)-3-amino-3-oxo-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-butoxybutanoate |
|---|---|
| PubChem CID | 122541392 |
| Molecular Formula | C23H40N6O6 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | butyl (2S)-2-[[(1S)-3-amino-3-oxo-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)propyl]carbamoylamino]-3-butoxybutanoate |
| SMILES | CCCCOC(=O)[C@@H](NC(=O)N[C@@H](CC(N)=O)c1nc(N2CCCCC2)no1)C(C)OCCCC |
| InChI | InChI=1S/C23H40N6O6/c1-4-6-13-33-16(3)19(21(31)34-14-7-5-2)26-23(32)25-17(15-18(24)30)20-27-22(28-35-20)29-11-9-8-10-12-29/h16-17,19H,4-15H2,1-3H3,(H2,24,30)(H2,25,26,32)/t16?,17-,19-/m0/s1 |
| InChIKey | OYIRYQFOOPNGLI-SJQFFEKCSA-N |
| XLogP | 2.19 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|