C19H26N6O6 — CID 122542123
(2S)-6-amino-2-[[(1S)-3-amino-1-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-oxopropyl]carbamoylamino]hexanoic acid (PubChem CID 122542123) has the molecular formula C19H26N6O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(1S)-3-amino-1-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-oxopropyl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(1S)-3-amino-1-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-oxopropyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 122542123 |
| Molecular Formula | C19H26N6O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (2S)-6-amino-2-[[(1S)-3-amino-1-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-oxopropyl]carbamoylamino]hexanoic acid |
| SMILES | COc1ccccc1-c1nnc([C@H](CC(N)=O)NC(=O)N[C@@H](CCCCN)C(=O)O)o1 |
| InChI | InChI=1S/C19H26N6O6/c1-30-14-8-3-2-6-11(14)16-24-25-17(31-16)13(10-15(21)26)23-19(29)22-12(18(27)28)7-4-5-9-20/h2-3,6,8,12-13H,4-5,7,9-10,20H2,1H3,(H2,21,26)(H,27,28)(H2,22,23,29)/t12-,13-/m0/s1 |
| InChIKey | SAUWXUYDAXFMAR-STQMWFEESA-N |
| XLogP | 0.54 |
| TPSA | 195.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|