C33H46N4O5S — CID 122542301
S-[(E)-4-[(6S,9S,12S)-6-methyl-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,17(21),18-pentaen-12-yl]but-3-enyl] octanethioate (PubChem CID 122542301) has the molecular formula C33H46N4O5S and a molecular weight of 610.82 g/mol. Its IUPAC name is S-[(E)-4-[(6S,9S,12S)-6-methyl-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,17(21),18-pentaen-12-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(6S,9S,12S)-6-methyl-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,17(21),18-pentaen-12-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 122542301 |
| Molecular Formula | C33H46N4O5S |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | S-[(E)-4-[(6S,9S,12S)-6-methyl-7,10,14-trioxo-9-propan-2-yl-11-oxa-8,15,21,22-tetrazatricyclo[15.3.1.12,6]docosa-1(20),2(22),3,17(21),18-pentaen-12-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2cccc(n2)C2=N[C@@](C)(CC=C2)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C33H46N4O5S/c1-5-6-7-8-9-18-29(39)43-20-11-10-15-25-21-28(38)34-22-24-14-12-16-26(35-24)27-17-13-19-33(4,37-27)32(41)36-30(23(2)3)31(40)42-25/h10,12-17,23,25,30H,5-9,11,18-22H2,1-4H3,(H,34,38)(H,36,41)/b15-10+/t25-,30+,33+/m1/s1 |
| InChIKey | LFFYQIVULOLHFX-VTDJWVLMSA-N |
| XLogP | 5.23 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|