About 3-propyl-3H-indole
3-propyl-3H-indole (PubChem CID 122542361) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-propyl-3H-indole.
Molecular Properties
| Compound Name | 3-propyl-3H-indole |
| PubChem CID | 122542361 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3-propyl-3H-indole |
| SMILES | CCCC1C=Nc2ccccc21 |
| InChI | InChI=1S/C11H13N/c1-2-5-9-8-12-11-7-4-3-6-10(9)11/h3-4,6-9H,2,5H2,1H3 |
| InChIKey | MLZUUPVPDXITSU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propyl-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-3H-indole?
The IUPAC name of 3-propyl-3H-indole (CID 122542361) is 3-propyl-3H-indole.
What is the SMILES notation for 3-propyl-3H-indole?
The canonical SMILES for 3-propyl-3H-indole is CCCC1C=Nc2ccccc21.
What is the InChIKey of 3-propyl-3H-indole?
The InChIKey is MLZUUPVPDXITSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-5-9-8-12-11-7-4-3-6-10(9)11/h3-4,6-9H,2,5H2,1H3.
What are the key properties of 3-propyl-3H-indole?
3-propyl-3H-indole has a molecular weight of 159.23 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-3H-indole is sourced from PubChem (CID 122542361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).