About bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate
bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate (PubChem CID 122542452) has the molecular formula C34H42F4O4
and a molecular weight of 590.70 g/mol. Its IUPAC name is bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate.
Molecular Properties
| Compound Name | bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate |
| PubChem CID | 122542452 |
| Molecular Formula | C34H42F4O4 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate |
| SMILES | CC(CCCC(=O)OC1CCC(c2ccc(F)c(F)c2)CC1)CCCC(=O)OC1CCC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C34H42F4O4/c1-22(4-2-6-33(39)41-27-14-8-23(9-15-27)25-12-18-29(35)31(37)20-25)5-3-7-34(40)42-28-16-10-24(11-17-28)26-13-19-30(36)32(38)21-26/h12-13,18-24,27-28H,2-11,14-17H2,1H3 |
| InChIKey | RNSJHAFTUCKBNE-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate?
The IUPAC name of bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate (CID 122542452) is bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate.
What is the SMILES notation for bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate?
The canonical SMILES for bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate is CC(CCCC(=O)OC1CCC(c2ccc(F)c(F)c2)CC1)CCCC(=O)OC1CCC(c2ccc(F)c(F)c2)CC1.
What is the InChIKey of bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate?
The InChIKey is RNSJHAFTUCKBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H42F4O4/c1-22(4-2-6-33(39)41-27-14-8-23(9-15-27)25-12-18-29(35)31(37)20-25)5-3-7-34(40)42-28-16-10-24(11-17-28)26-13-19-30(36)32(38)21-26/h12-13,18-24,27-28H,2-11,14-17H2,1H3.
What are the key properties of bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate?
bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate has a molecular weight of 590.70 g/mol, XLogP of 9.06, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(3,4-difluorophenyl)cyclohexyl] 5-methylnonanedioate is sourced from PubChem (CID 122542452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).