C13H15F3N3O13P3S — CID 122543455
[[(2R,4S,5S)-3,4-dihydroxy-5-[6-sulfanylidene-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543455) has the molecular formula C13H15F3N3O13P3S and a molecular weight of 603.25 g/mol. Its IUPAC name is [[(2R,4S,5S)-3,4-dihydroxy-5-[6-sulfanylidene-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5S)-3,4-dihydroxy-5-[6-sulfanylidene-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543455 |
| Molecular Formula | C13H15F3N3O13P3S |
| Molecular Weight | 603.25 g/mol |
| Exact Mass | 602.95 |
| IUPAC Name | [[(2R,4S,5S)-3,4-dihydroxy-5-[6-sulfanylidene-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](c2cc3ncc(C(F)(F)F)nc3[nH]c2=S)[C@@H](O)C1O |
| InChI | InChI=1S/C13H15F3N3O13P3S/c14-13(15,16)7-2-17-5-1-4(12(36)19-11(5)18-7)10-9(21)8(20)6(30-10)3-29-34(25,26)32-35(27,28)31-33(22,23)24/h1-2,6,8-10,20-21H,3H2,(H,25,26)(H,27,28)(H,18,19,36)(H2,22,23,24)/t6-,8?,9+,10+/m1/s1 |
| InChIKey | QAVBRRYVKWVRRO-DSKHZARWSA-N |
| XLogP | 1.21 |
| TPSA | 251.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|