About 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione
5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione (PubChem CID 122543597) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 122543597 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Cc2cn[nH]n2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N5O2/c1-5(2)8-7(3-6-4-11-15-14-6)12-10(17)13-9(8)16/h4-5H,3H2,1-2H3,(H,11,14,15)(H2,12,13,16,17) |
| InChIKey | SQPJHAZATPOYOU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione (CID 122543597) is 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione is CC(C)c1c(Cc2cn[nH]n2)[nH]c(=O)[nH]c1=O.
What is the InChIKey of 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
The InChIKey is SQPJHAZATPOYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-5(2)8-7(3-6-4-11-15-14-6)12-10(17)13-9(8)16/h4-5H,3H2,1-2H3,(H,11,14,15)(H2,12,13,16,17).
What are the key properties of 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione has a molecular weight of 235.25 g/mol, XLogP of -0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-6-(2H-triazol-4-ylmethyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 122543597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).