About 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione
3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (PubChem CID 122543749) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
Molecular Properties
| Compound Name | 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| PubChem CID | 122543749 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| SMILES | Cc1cn2cc(C(C)C)c(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C11H13N3O2/c1-6(2)8-5-14-4-7(3)9(15)12-11(14)13-10(8)16/h4-6H,1-3H3,(H,12,13,15,16) |
| InChIKey | QCTNMQATVWJOPN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The IUPAC name of 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (CID 122543749) is 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
What is the SMILES notation for 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The canonical SMILES for 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is Cc1cn2cc(C(C)C)c(=O)[nH]c2nc1=O.
What is the InChIKey of 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The InChIKey is QCTNMQATVWJOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-6(2)8-5-14-4-7(3)9(15)12-11(14)13-10(8)16/h4-6H,1-3H3,(H,12,13,15,16).
What are the key properties of 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione has a molecular weight of 219.24 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is sourced from PubChem (CID 122543749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).