About 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione
6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (PubChem CID 122543751) has the molecular formula C11H12FN3O2
and a molecular weight of 237.23 g/mol. Its IUPAC name is 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
Molecular Properties
| Compound Name | 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| PubChem CID | 122543751 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| SMILES | Cc1c(F)n2cc(C(C)C)c(=O)nc2[nH]c1=O |
| InChI | InChI=1S/C11H12FN3O2/c1-5(2)7-4-15-8(12)6(3)9(16)13-11(15)14-10(7)17/h4-5H,1-3H3,(H,13,14,16,17) |
| InChIKey | WINNLTRVNQKEPL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The IUPAC name of 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (CID 122543751) is 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
What is the SMILES notation for 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The canonical SMILES for 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is Cc1c(F)n2cc(C(C)C)c(=O)nc2[nH]c1=O.
What is the InChIKey of 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The InChIKey is WINNLTRVNQKEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN3O2/c1-5(2)7-4-15-8(12)6(3)9(16)13-11(15)14-10(7)17/h4-5H,1-3H3,(H,13,14,16,17).
What are the key properties of 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione has a molecular weight of 237.23 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-methyl-3-propan-2-yl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is sourced from PubChem (CID 122543751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).