C31H32N2O4 — CID 122543818
5-[(2S,3R,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxypyrimidine (PubChem CID 122543818) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 5-[(2S,3R,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxypyrimidine.
| Compound Name | 5-[(2S,3R,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxypyrimidine |
|---|---|
| PubChem CID | 122543818 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 5-[(2S,3R,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxypyrimidine |
| SMILES | CC[C@H]1O[C@@H](c2cnc(OCc3ccccc3)nc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C31H32N2O4/c1-2-27-29(34-20-23-12-6-3-7-13-23)30(35-21-24-14-8-4-9-15-24)28(37-27)26-18-32-31(33-19-26)36-22-25-16-10-5-11-17-25/h3-19,27-30H,2,20-22H2,1H3/t27-,28+,29?,30-/m1/s1 |
| InChIKey | FATKFOOIQQSLFW-LKDZJTDUSA-N |
| XLogP | 6.08 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |