About [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol
[(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol (PubChem CID 122543875) has the molecular formula C9H10OS4
and a molecular weight of 262.45 g/mol. Its IUPAC name is [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol.
Molecular Properties
| Compound Name | [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol |
| PubChem CID | 122543875 |
| Molecular Formula | C9H10OS4 |
| Molecular Weight | 262.45 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol |
| SMILES | CCC1=CS/C(=C2/SC=C(CO)S2)S1 |
| InChI | InChI=1S/C9H10OS4/c1-2-6-4-11-8(13-6)9-12-5-7(3-10)14-9/h4-5,10H,2-3H2,1H3/b9-8+ |
| InChIKey | GLKWUQIQGKEALF-CMDGGOBGSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
The IUPAC name of [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol (CID 122543875) is [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol.
What is the SMILES notation for [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
The canonical SMILES for [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol is CCC1=CS/C(=C2/SC=C(CO)S2)S1.
What is the InChIKey of [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
The InChIKey is GLKWUQIQGKEALF-CMDGGOBGSA-N. The full InChI is InChI=1S/C9H10OS4/c1-2-6-4-11-8(13-6)9-12-5-7(3-10)14-9/h4-5,10H,2-3H2,1H3/b9-8+.
What are the key properties of [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
[(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol has a molecular weight of 262.45 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-2-(4-ethyl-1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol is sourced from PubChem (CID 122543875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).