C11H13NO — CID 122544055
7-methyl-6-nitroso-1,2,8,8a-tetrahydronaphthalene (PubChem CID 122544055) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 7-methyl-6-nitroso-1,2,8,8a-tetrahydronaphthalene.
| Compound Name | 7-methyl-6-nitroso-1,2,8,8a-tetrahydronaphthalene |
|---|---|
| PubChem CID | 122544055 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 7-methyl-6-nitroso-1,2,8,8a-tetrahydronaphthalene |
| SMILES | CC1=C(N=O)C=C2C=CCCC2C1 |
| InChI | InChI=1S/C11H13NO/c1-8-6-9-4-2-3-5-10(9)7-11(8)12-13/h3,5,7,9H,2,4,6H2,1H3 |
| InChIKey | YTTRJVPYXOFZQT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |