About (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone
(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone (PubChem CID 122544408) has the molecular formula C11H15N3OS
and a molecular weight of 237.33 g/mol. Its IUPAC name is (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone |
| PubChem CID | 122544408 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone |
| SMILES | CN1CC2CCC(C1)N2C(=O)c1cncs1 |
| InChI | InChI=1S/C11H15N3OS/c1-13-5-8-2-3-9(6-13)14(8)11(15)10-4-12-7-16-10/h4,7-9H,2-3,5-6H2,1H3 |
| InChIKey | HLSUZLPGXXFJLP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone?
The IUPAC name of (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone (CID 122544408) is (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone.
What is the SMILES notation for (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone?
The canonical SMILES for (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone is CN1CC2CCC(C1)N2C(=O)c1cncs1.
What is the InChIKey of (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone?
The InChIKey is HLSUZLPGXXFJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS/c1-13-5-8-2-3-9(6-13)14(8)11(15)10-4-12-7-16-10/h4,7-9H,2-3,5-6H2,1H3.
What are the key properties of (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone?
(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone has a molecular weight of 237.33 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)-(1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 122544408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).