C13H19FO2S — CID 122544443
2-fluoro-2,3,3,4,5-pentamethyl-4,5-dihydro-1-benzothiophene 1,1-dioxide (PubChem CID 122544443) has the molecular formula C13H19FO2S and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-fluoro-2,3,3,4,5-pentamethyl-4,5-dihydro-1-benzothiophene 1,1-dioxide.
| Compound Name | 2-fluoro-2,3,3,4,5-pentamethyl-4,5-dihydro-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 122544443 |
| Molecular Formula | C13H19FO2S |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-fluoro-2,3,3,4,5-pentamethyl-4,5-dihydro-1-benzothiophene 1,1-dioxide |
| SMILES | CC1C=CC2=C(C1C)C(C)(C)C(C)(F)S2(=O)=O |
| InChI | InChI=1S/C13H19FO2S/c1-8-6-7-10-11(9(8)2)12(3,4)13(5,14)17(10,15)16/h6-9H,1-5H3 |
| InChIKey | VJTNRGXGSFNAOT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |