About 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate
3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate (PubChem CID 122544445) has the molecular formula C12H15O4S-
and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate.
Molecular Properties
| Compound Name | 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate |
| PubChem CID | 122544445 |
| Molecular Formula | C12H15O4S- |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate |
| SMILES | CCCOc1ccc(S(=O)[O-])c2c1CCC2O |
| InChI | InChI=1S/C12H16O4S/c1-2-7-16-10-5-6-11(17(14)15)12-8(10)3-4-9(12)13/h5-6,9,13H,2-4,7H2,1H3,(H,14,15)/p-1 |
| InChIKey | ATIBIKGCSIUOSY-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate?
The IUPAC name of 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate (CID 122544445) is 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate.
What is the SMILES notation for 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate?
The canonical SMILES for 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate is CCCOc1ccc(S(=O)[O-])c2c1CCC2O.
What is the InChIKey of 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate?
The InChIKey is ATIBIKGCSIUOSY-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16O4S/c1-2-7-16-10-5-6-11(17(14)15)12-8(10)3-4-9(12)13/h5-6,9,13H,2-4,7H2,1H3,(H,14,15)/p-1.
What are the key properties of 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate?
3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate has a molecular weight of 255.31 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-7-propoxy-2,3-dihydro-1H-indene-4-sulfinate is sourced from PubChem (CID 122544445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).