C21H32N3O8PS — CID 122544595
[1-[(2R,4S,5S)-3,4-dihydroxy-5-(2-oxo-7-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-6-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid (PubChem CID 122544595) has the molecular formula C21H32N3O8PS and a molecular weight of 517.54 g/mol. Its IUPAC name is [1-[(2R,4S,5S)-3,4-dihydroxy-5-(2-oxo-7-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-6-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid.
| Compound Name | [1-[(2R,4S,5S)-3,4-dihydroxy-5-(2-oxo-7-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-6-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 122544595 |
| Molecular Formula | C21H32N3O8PS |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | [1-[(2R,4S,5S)-3,4-dihydroxy-5-(2-oxo-7-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-6-yl)oxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid |
| SMILES | CCC(C)(C[C@H]1O[C@@H](c2cc3cnc(=O)[nH]c3[nH]c2=S)[C@@H](O)C1O)OP(=O)(O)C(O)(CC)CC |
| InChI | InChI=1S/C21H32N3O8PS/c1-5-20(4,32-33(29,30)21(28,6-2)7-3)9-13-14(25)15(26)16(31-13)12-8-11-10-22-19(27)24-17(11)23-18(12)34/h8,10,13-16,25-26,28H,5-7,9H2,1-4H3,(H,29,30)(H2,22,23,24,27,34)/t13-,14?,15+,16+,20?/m1/s1 |
| InChIKey | KGKWXVOKURKFDQ-RLVYFCSOSA-N |
| XLogP | 2.41 |
| TPSA | 177.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|