C13H21NO3 — CID 122544657
1-(3-methyloxan-2-yl)-2-piperidin-1-ylethane-1,2-dione (PubChem CID 122544657) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-(3-methyloxan-2-yl)-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-(3-methyloxan-2-yl)-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 122544657 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(3-methyloxan-2-yl)-2-piperidin-1-ylethane-1,2-dione |
| SMILES | CC1CCCOC1C(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H21NO3/c1-10-6-5-9-17-12(10)11(15)13(16)14-7-3-2-4-8-14/h10,12H,2-9H2,1H3 |
| InChIKey | JQXYYHCFTVYUSZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|