C18H26N3O9P — CID 122544744
[1-[(2R,4S,5R)-5-(5,6-dimethyl-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl] dihydrogen phosphate (PubChem CID 122544744) has the molecular formula C18H26N3O9P and a molecular weight of 459.39 g/mol. Its IUPAC name is [1-[(2R,4S,5R)-5-(5,6-dimethyl-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl] dihydrogen phosphate.
| Compound Name | [1-[(2R,4S,5R)-5-(5,6-dimethyl-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 122544744 |
| Molecular Formula | C18H26N3O9P |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [1-[(2R,4S,5R)-5-(5,6-dimethyl-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl] dihydrogen phosphate |
| SMILES | CCC(C)(C[C@H]1O[C@@H](n2cc3c(C)c(C)c(=O)[nH]c3nc2=O)[C@@H](O)C1O)OP(=O)(O)O |
| InChI | InChI=1S/C18H26N3O9P/c1-5-18(4,30-31(26,27)28)6-11-12(22)13(23)16(29-11)21-7-10-8(2)9(3)15(24)19-14(10)20-17(21)25/h7,11-13,16,22-23H,5-6H2,1-4H3,(H2,26,27,28)(H,19,20,24,25)/t11-,12?,13+,16-,18?/m1/s1 |
| InChIKey | XFRSIBTXINFQOI-YJOFGBAYSA-N |
| XLogP | -0.01 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|