About 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one
3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 122544848) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 122544848 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc2cn(C)c(=S)nc2[nH]c1=O |
| InChI | InChI=1S/C9H9N3OS/c1-5-3-6-4-12(2)9(14)11-7(6)10-8(5)13/h3-4H,1-2H3,(H,10,11,13,14) |
| InChIKey | FBILJNMJHSJQTQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one (CID 122544848) is 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one is Cc1cc2cn(C)c(=S)nc2[nH]c1=O.
What is the InChIKey of 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is FBILJNMJHSJQTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-5-3-6-4-12(2)9(14)11-7(6)10-8(5)13/h3-4H,1-2H3,(H,10,11,13,14).
What are the key properties of 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one?
3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 207.26 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 122544848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).