About 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one
4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one (PubChem CID 122544858) has the molecular formula C7H7F2NO
and a molecular weight of 159.13 g/mol. Its IUPAC name is 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one |
| PubChem CID | 122544858 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.13 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1c(F)[nH]c(=O)c(C)c1F |
| InChI | InChI=1S/C7H7F2NO/c1-3-5(8)4(2)7(11)10-6(3)9/h1-2H3,(H,10,11) |
| InChIKey | ZTHYYOJHPLGYOP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one?
The IUPAC name of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one (CID 122544858) is 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one is Cc1c(F)[nH]c(=O)c(C)c1F.
What is the InChIKey of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one?
The InChIKey is ZTHYYOJHPLGYOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO/c1-3-5(8)4(2)7(11)10-6(3)9/h1-2H3,(H,10,11).
What are the key properties of 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one?
4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one has a molecular weight of 159.13 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-difluoro-3,5-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 122544858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).