C26H44FNO6 — CID 122544871
(4S,5R)-3,4-dibutoxy-2-(6-butoxy-2-fluoro-3-pyridinyl)-5-(butoxymethyl)oxolan-2-ol (PubChem CID 122544871) has the molecular formula C26H44FNO6 and a molecular weight of 485.64 g/mol. Its IUPAC name is (4S,5R)-3,4-dibutoxy-2-(6-butoxy-2-fluoro-3-pyridinyl)-5-(butoxymethyl)oxolan-2-ol.
| Compound Name | (4S,5R)-3,4-dibutoxy-2-(6-butoxy-2-fluoro-3-pyridinyl)-5-(butoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 122544871 |
| Molecular Formula | C26H44FNO6 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | (4S,5R)-3,4-dibutoxy-2-(6-butoxy-2-fluoro-3-pyridinyl)-5-(butoxymethyl)oxolan-2-ol |
| SMILES | CCCCOC[C@H]1OC(O)(c2ccc(OCCCC)nc2F)C(OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C26H44FNO6/c1-5-9-15-30-19-21-23(32-17-11-7-3)24(33-18-12-8-4)26(29,34-21)20-13-14-22(28-25(20)27)31-16-10-6-2/h13-14,21,23-24,29H,5-12,15-19H2,1-4H3/t21-,23+,24?,26?/m1/s1 |
| InChIKey | PECWIZUFXLBSGZ-DGMIJEGXSA-N |
| XLogP | 5.13 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|