About 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione
6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 122544889) has the molecular formula C8H8FN3S
and a molecular weight of 197.24 g/mol. Its IUPAC name is 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
| PubChem CID | 122544889 |
| Molecular Formula | C8H8FN3S |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | Cc1c(F)[nH]c2nc(=S)n(C)cc12 |
| InChI | InChI=1S/C8H8FN3S/c1-4-5-3-12(2)8(13)11-7(5)10-6(4)9/h3H,1-2H3,(H,10,11,13) |
| InChIKey | VEXILHGSQUHWLF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione?
The IUPAC name of 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione (CID 122544889) is 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione.
What is the SMILES notation for 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione?
The canonical SMILES for 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione is Cc1c(F)[nH]c2nc(=S)n(C)cc12.
What is the InChIKey of 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione?
The InChIKey is VEXILHGSQUHWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3S/c1-4-5-3-12(2)8(13)11-7(5)10-6(4)9/h3H,1-2H3,(H,10,11,13).
What are the key properties of 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione?
6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione has a molecular weight of 197.24 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidine-2-thione is sourced from PubChem (CID 122544889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).