C21H31FN3O7PS — CID 122544943
[1-[(2R,4S,5S)-5-(2-fluoro-3-methyl-6-sulfanylidene-5H-pyrido[2,3-b]pyrazin-7-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid (PubChem CID 122544943) has the molecular formula C21H31FN3O7PS and a molecular weight of 519.53 g/mol. Its IUPAC name is [1-[(2R,4S,5S)-5-(2-fluoro-3-methyl-6-sulfanylidene-5H-pyrido[2,3-b]pyrazin-7-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid.
| Compound Name | [1-[(2R,4S,5S)-5-(2-fluoro-3-methyl-6-sulfanylidene-5H-pyrido[2,3-b]pyrazin-7-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 122544943 |
| Molecular Formula | C21H31FN3O7PS |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | [1-[(2R,4S,5S)-5-(2-fluoro-3-methyl-6-sulfanylidene-5H-pyrido[2,3-b]pyrazin-7-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
| SMILES | CCC(C)(C[C@H]1O[C@@H](c2cc3nc(F)c(C)nc3[nH]c2=S)[C@@H](O)C1O)OP(=O)(O)C(C)(O)CC |
| InChI | InChI=1S/C21H31FN3O7PS/c1-6-20(4,32-33(29,30)21(5,28)7-2)9-13-14(26)15(27)16(31-13)11-8-12-18(25-19(11)34)23-10(3)17(22)24-12/h8,13-16,26-28H,6-7,9H2,1-5H3,(H,29,30)(H,23,25,34)/t13-,14?,15+,16+,20?,21?/m1/s1 |
| InChIKey | RFDNTNCUNVUJFY-YKBDWTOTSA-N |
| XLogP | 3.18 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|