C21H29F3N3O8P — CID 122544984
[1-[(2R,4S,5S)-3,4-dihydroxy-5-[6-oxo-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid (PubChem CID 122544984) has the molecular formula C21H29F3N3O8P and a molecular weight of 539.44 g/mol. Its IUPAC name is [1-[(2R,4S,5S)-3,4-dihydroxy-5-[6-oxo-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid.
| Compound Name | [1-[(2R,4S,5S)-3,4-dihydroxy-5-[6-oxo-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 122544984 |
| Molecular Formula | C21H29F3N3O8P |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | [1-[(2R,4S,5S)-3,4-dihydroxy-5-[6-oxo-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazin-7-yl]oxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
| SMILES | CCC(C)(C[C@H]1O[C@@H](c2cc3ncc(C(F)(F)F)nc3[nH]c2=O)[C@@H](O)C1O)OP(=O)(O)C(C)(O)CC |
| InChI | InChI=1S/C21H29F3N3O8P/c1-5-19(3,35-36(32,33)20(4,31)6-2)8-12-14(28)15(29)16(34-12)10-7-11-17(27-18(10)30)26-13(9-25-11)21(22,23)24/h7,9,12,14-16,28-29,31H,5-6,8H2,1-4H3,(H,32,33)(H,26,27,30)/t12-,14?,15+,16+,19?,20?/m1/s1 |
| InChIKey | NTBHXYXFEVMWPC-ISAQHRSXSA-N |
| XLogP | 2.38 |
| TPSA | 175.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|