C24H23Cl2N3O4 — CID 122545491
4-[4-[5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-3-methylbenzoyl]-1-ethylpiperazine-2,6-dione (PubChem CID 122545491) has the molecular formula C24H23Cl2N3O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is 4-[4-[5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-3-methylbenzoyl]-1-ethylpiperazine-2,6-dione.
| Compound Name | 4-[4-[5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-3-methylbenzoyl]-1-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 122545491 |
| Molecular Formula | C24H23Cl2N3O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 4-[4-[5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-3-methylbenzoyl]-1-ethylpiperazine-2,6-dione |
| SMILES | CCN1C(=O)CN(C(=O)c2ccc(C3=NOC(C)(c4cc(Cl)cc(Cl)c4)C3)c(C)c2)CC1=O |
| InChI | InChI=1S/C24H23Cl2N3O4/c1-4-29-21(30)12-28(13-22(29)31)23(32)15-5-6-19(14(2)7-15)20-11-24(3,33-27-20)16-8-17(25)10-18(26)9-16/h5-10H,4,11-13H2,1-3H3 |
| InChIKey | YYGJIGVVZWFXEI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|