About 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine
1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine (PubChem CID 122545506) has the molecular formula C14H26F2N2
and a molecular weight of 260.37 g/mol. Its IUPAC name is 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine |
| PubChem CID | 122545506 |
| Molecular Formula | C14H26F2N2 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine |
| SMILES | CC[C@H]1CCCN(CCN2CCCC(F)(F)C2)C1 |
| InChI | InChI=1S/C14H26F2N2/c1-2-13-5-3-7-17(11-13)9-10-18-8-4-6-14(15,16)12-18/h13H,2-12H2,1H3/t13-/m0/s1 |
| InChIKey | ANOIXMQKIZYWPL-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine?
The IUPAC name of 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine (CID 122545506) is 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine.
What is the SMILES notation for 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine?
The canonical SMILES for 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine is CC[C@H]1CCCN(CCN2CCCC(F)(F)C2)C1.
What is the InChIKey of 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine?
The InChIKey is ANOIXMQKIZYWPL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H26F2N2/c1-2-13-5-3-7-17(11-13)9-10-18-8-4-6-14(15,16)12-18/h13H,2-12H2,1H3/t13-/m0/s1.
What are the key properties of 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine?
1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine has a molecular weight of 260.37 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3S)-3-ethylpiperidin-1-yl]ethyl]-3,3-difluoropiperidine is sourced from PubChem (CID 122545506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).