About (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one
(4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one (PubChem CID 122545542) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one.
Molecular Properties
| Compound Name | (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one |
| PubChem CID | 122545542 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one |
| SMILES | C=C(C)C(=O)[C@@H](C)CC1CCCO1 |
| InChI | InChI=1S/C11H18O2/c1-8(2)11(12)9(3)7-10-5-4-6-13-10/h9-10H,1,4-7H2,2-3H3/t9-,10?/m0/s1 |
| InChIKey | QBZSHVHIQDANRG-RGURZIINSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one?
The IUPAC name of (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one (CID 122545542) is (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one.
What is the SMILES notation for (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one?
The canonical SMILES for (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one is C=C(C)C(=O)[C@@H](C)CC1CCCO1.
What is the InChIKey of (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one?
The InChIKey is QBZSHVHIQDANRG-RGURZIINSA-N. The full InChI is InChI=1S/C11H18O2/c1-8(2)11(12)9(3)7-10-5-4-6-13-10/h9-10H,1,4-7H2,2-3H3/t9-,10?/m0/s1.
What are the key properties of (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one?
(4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one has a molecular weight of 182.26 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4-dimethyl-5-(oxolan-2-yl)pent-1-en-3-one is sourced from PubChem (CID 122545542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).