About (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine
(1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine (PubChem CID 122546031) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine.
Molecular Properties
| Compound Name | (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine |
| PubChem CID | 122546031 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine |
| SMILES | C/C=C\C/C(N)=C/N(C)N |
| InChI | InChI=1S/C7H15N3/c1-3-4-5-7(8)6-10(2)9/h3-4,6H,5,8-9H2,1-2H3/b4-3-,7-6- |
| InChIKey | MIPOPINNXPFWJK-CWWKMNTPSA-N |
| XLogP | 0.56 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine?
The IUPAC name of (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine (CID 122546031) is (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine.
What is the SMILES notation for (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine?
The canonical SMILES for (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine is C/C=C\C/C(N)=C/N(C)N.
What is the InChIKey of (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine?
The InChIKey is MIPOPINNXPFWJK-CWWKMNTPSA-N. The full InChI is InChI=1S/C7H15N3/c1-3-4-5-7(8)6-10(2)9/h3-4,6H,5,8-9H2,1-2H3/b4-3-,7-6-.
What are the key properties of (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine?
(1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine has a molecular weight of 141.22 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,4Z)-1-[amino(methyl)amino]hexa-1,4-dien-2-amine is sourced from PubChem (CID 122546031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).