C11H12F4O2 — CID 122546116
2,2,3,3-tetrafluoropropyl (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 122546116) has the molecular formula C11H12F4O2 and a molecular weight of 252.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,3,3-tetrafluoropropyl (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 122546116 |
| Molecular Formula | C11H12F4O2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC(F)(F)C(F)F)[C@H]1CC2C=CC1C2 |
| InChI | InChI=1S/C11H12F4O2/c12-10(13)11(14,15)5-17-9(16)8-4-6-1-2-7(8)3-6/h1-2,6-8,10H,3-5H2/t6?,7?,8-/m0/s1 |
| InChIKey | NTLYZSNVRFCLDN-RRQHEKLDSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|