C16H28O3 — CID 122546349
1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-9-ol (PubChem CID 122546349) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-9-ol.
| Compound Name | 1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-9-ol |
|---|---|
| PubChem CID | 122546349 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1,8-dimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracen-9-ol |
| SMILES | COC1CCCC2CC3CCCC(OC)C3C(O)C21 |
| InChI | InChI=1S/C16H28O3/c1-18-12-7-3-5-10-9-11-6-4-8-13(19-2)15(11)16(17)14(10)12/h10-17H,3-9H2,1-2H3 |
| InChIKey | JQSPTRHQWKNAHM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |