C76H81NO — CID 122546405
10-[3,5-bis[3,5-bis(4-pentylphenyl)phenyl]phenyl]-3,7-dimethylphenoxazine (PubChem CID 122546405) has the molecular formula C76H81NO and a molecular weight of 1024.49 g/mol. Its IUPAC name is 10-[3,5-bis[3,5-bis(4-pentylphenyl)phenyl]phenyl]-3,7-dimethylphenoxazine.
| Compound Name | 10-[3,5-bis[3,5-bis(4-pentylphenyl)phenyl]phenyl]-3,7-dimethylphenoxazine |
|---|---|
| PubChem CID | 122546405 |
| Molecular Formula | C76H81NO |
| Molecular Weight | 1024.49 g/mol |
| Exact Mass | 1023.63 |
| IUPAC Name | 10-[3,5-bis[3,5-bis(4-pentylphenyl)phenyl]phenyl]-3,7-dimethylphenoxazine |
| SMILES | CCCCCc1ccc(-c2cc(-c3ccc(CCCCC)cc3)cc(-c3cc(-c4cc(-c5ccc(CCCCC)cc5)cc(-c5ccc(CCCCC)cc5)c4)cc(N4c5ccc(C)cc5Oc5cc(C)ccc54)c3)c2)cc1 |
| InChI | InChI=1S/C76H81NO/c1-7-11-15-19-56-25-33-60(34-26-56)64-45-65(61-35-27-57(28-36-61)20-16-12-8-2)48-68(47-64)70-51-71(53-72(52-70)77-73-41-23-54(5)43-75(73)78-76-44-55(6)24-42-74(76)77)69-49-66(62-37-29-58(30-38-62)21-17-13-9-3)46-67(50-69)63-39-31-59(32-40-63)22-18-14-10-4/h23-53H,7-22H2,1-6H3 |
| InChIKey | CFYYADMQFPVGNZ-UHFFFAOYSA-N |
| XLogP | 22.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.49 |
| LogP ≤ 5 | 22.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|