C20H34O9 — CID 122546426
2-[(1S,3S,4S,5R,7S,8S,9R,11R)-5-[(2R)-2,3-dihydroxypropyl]-4,8-dihydroxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 122546426) has the molecular formula C20H34O9 and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-[(1S,3S,4S,5R,7S,8S,9R,11R)-5-[(2R)-2,3-dihydroxypropyl]-4,8-dihydroxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(1S,3S,4S,5R,7S,8S,9R,11R)-5-[(2R)-2,3-dihydroxypropyl]-4,8-dihydroxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122546426 |
| Molecular Formula | C20H34O9 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[(1S,3S,4S,5R,7S,8S,9R,11R)-5-[(2R)-2,3-dihydroxypropyl]-4,8-dihydroxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC[C@H]1CC[C@@H]2O[C@H]3[C@@H](O)[C@@H](C[C@@H](O)CO)O[C@H]3[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C20H34O9/c1-20(2,3)19(25)26-7-6-11-4-5-12-16(27-11)15(24)18-17(28-12)14(23)13(29-18)8-10(22)9-21/h10-18,21-24H,4-9H2,1-3H3/t10-,11-,12+,13-,14+,15+,16+,17+,18+/m1/s1 |
| InChIKey | QCWAKRLHYOBAKO-SZMYRTGISA-N |
| XLogP | -0.49 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |