C26H40O8S — CID 122546480
(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[[(2R,4R,6S)-6-(3-hydroxypropyl)-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxyoxolan-2-yl]propane-1,2-diol (PubChem CID 122546480) has the molecular formula C26H40O8S and a molecular weight of 512.67 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[[(2R,4R,6S)-6-(3-hydroxypropyl)-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxyoxolan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[[(2R,4R,6S)-6-(3-hydroxypropyl)-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxyoxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 122546480 |
| Molecular Formula | C26H40O8S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-[[(2R,4R,6S)-6-(3-hydroxypropyl)-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxyoxolan-2-yl]propane-1,2-diol |
| SMILES | C=C1[C@H](C)C[C@H](CCCO)O[C@@H]1C[C@@H]1O[C@H](C[C@H](O)CO)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H40O8S/c1-17-12-20(8-7-11-27)33-23(18(17)2)14-24-22(16-35(30,31)21-9-5-4-6-10-21)26(32-3)25(34-24)13-19(29)15-28/h4-6,9-10,17,19-20,22-29H,2,7-8,11-16H2,1,3H3/t17-,19+,20+,22+,23-,24+,25-,26-/m1/s1 |
| InChIKey | MEVKKHRPINYFSE-QYBHNRALSA-N |
| XLogP | 2.11 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|