About (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane
(1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane (PubChem CID 122546546) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane |
| PubChem CID | 122546546 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane |
| SMILES | COC[C@]12CCC[C@](COC)(CC1)O2 |
| InChI | InChI=1S/C11H20O3/c1-12-8-10-4-3-5-11(14-10,7-6-10)9-13-2/h3-9H2,1-2H3/t10-,11+ |
| InChIKey | RBQNHYYERKIIPF-PHIMTYICSA-N |
| XLogP | 1.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane?
The IUPAC name of (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane (CID 122546546) is (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane.
What is the SMILES notation for (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane?
The canonical SMILES for (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane is COC[C@]12CCC[C@](COC)(CC1)O2.
What is the InChIKey of (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane?
The InChIKey is RBQNHYYERKIIPF-PHIMTYICSA-N. The full InChI is InChI=1S/C11H20O3/c1-12-8-10-4-3-5-11(14-10,7-6-10)9-13-2/h3-9H2,1-2H3/t10-,11+.
What are the key properties of (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane?
(1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane has a molecular weight of 200.28 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-1,5-bis(methoxymethyl)-8-oxabicyclo[3.2.1]octane is sourced from PubChem (CID 122546546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).