C24H26NO6S+ — CID 122547032
3-[2-[(E)-2-(2-hydroxy-5-prop-2-enoyloxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 122547032) has the molecular formula C24H26NO6S+ and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[2-[(E)-2-(2-hydroxy-5-prop-2-enoyloxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E)-2-(2-hydroxy-5-prop-2-enoyloxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 122547032 |
| Molecular Formula | C24H26NO6S+ |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[2-[(E)-2-(2-hydroxy-5-prop-2-enoyloxyphenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | C=CC(=O)Oc1ccc(O)c(/C=C/C2=[N+](CCCS(=O)(=O)O)c3ccccc3C2(C)C)c1 |
| InChI | InChI=1S/C24H25NO6S/c1-4-23(27)31-18-11-12-21(26)17(16-18)10-13-22-24(2,3)19-8-5-6-9-20(19)25(22)14-7-15-32(28,29)30/h4-6,8-13,16H,1,7,14-15H2,2-3H3,(H,28,29,30)/p+1 |
| InChIKey | YZRIQFYYEYHGGB-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|