C28H47N5O6 — CID 122547594
tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-hydrazinyl-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 122547594) has the molecular formula C28H47N5O6 and a molecular weight of 549.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-hydrazinyl-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-hydrazinyl-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 122547594 |
| Molecular Formula | C28H47N5O6 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S,3R)-1-hydrazinyl-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)N[C@H](C(=O)NN)[C@@H](C)OC(C)(C)C |
| InChI | InChI=1S/C28H47N5O6/c1-17(2)15-20(24(35)32-22(25(36)33-29)18(3)38-27(4,5)6)30-23(34)21(16-19-13-11-10-12-14-19)31-26(37)39-28(7,8)9/h10-14,17-18,20-22H,15-16,29H2,1-9H3,(H,30,34)(H,31,37)(H,32,35)(H,33,36)/t18-,20+,21+,22+/m1/s1 |
| InChIKey | LKKKMTUGZPVIIN-GBAJDQEWSA-N |
| XLogP | 2.33 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|