C26H10Cl4N4S4 — CID 122547669
2,8-bis[5-(3,4-dichlorophenyl)thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 122547669) has the molecular formula C26H10Cl4N4S4 and a molecular weight of 648.47 g/mol. Its IUPAC name is 2,8-bis[5-(3,4-dichlorophenyl)thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis[5-(3,4-dichlorophenyl)thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 122547669 |
| Molecular Formula | C26H10Cl4N4S4 |
| Molecular Weight | 648.47 g/mol |
| Exact Mass | 645.85 |
| IUPAC Name | 2,8-bis[5-(3,4-dichlorophenyl)thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | Clc1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(Cl)c(Cl)c6)s5)c5nsnc35)N=S=N4)s2)cc1Cl |
| InChI | InChI=1S/C26H10Cl4N4S4/c27-13-3-1-11(9-15(13)29)17-5-7-19(35-17)21-23-25(33-37-31-23)22(26-24(21)32-38-34-26)20-8-6-18(36-20)12-2-4-14(28)16(30)10-12/h1-10H |
| InChIKey | LMGBMXZJSPEGOG-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.47 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |