C23H21Cl2NO2 — CID 122548007
(2Z)-2-[6-(3,5-dichlorophenoxy)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]acetonitrile (PubChem CID 122548007) has the molecular formula C23H21Cl2NO2 and a molecular weight of 414.33 g/mol. Its IUPAC name is (2Z)-2-[6-(3,5-dichlorophenoxy)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]acetonitrile.
| Compound Name | (2Z)-2-[6-(3,5-dichlorophenoxy)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 122548007 |
| Molecular Formula | C23H21Cl2NO2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (2Z)-2-[6-(3,5-dichlorophenoxy)-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-ylidene]acetonitrile |
| SMILES | COC1CCC2(CC1)Cc1ccc(Oc3cc(Cl)cc(Cl)c3)cc1/C2=C\C#N |
| InChI | InChI=1S/C23H21Cl2NO2/c1-27-18-4-7-23(8-5-18)14-15-2-3-19(13-21(15)22(23)6-9-26)28-20-11-16(24)10-17(25)12-20/h2-3,6,10-13,18H,4-5,7-8,14H2,1H3/b22-6+ |
| InChIKey | VETZZNHZFNTFFN-GEVRCRHISA-N |
| XLogP | 6.82 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|