About (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol
(6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol (PubChem CID 122548054) has the molecular formula C7H14FNO2
and a molecular weight of 163.19 g/mol. Its IUPAC name is (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol.
Molecular Properties
| Compound Name | (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol |
| PubChem CID | 122548054 |
| Molecular Formula | C7H14FNO2 |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol |
| SMILES | CN1CCOC[C@@H](O)[C@H](F)C1 |
| InChI | InChI=1S/C7H14FNO2/c1-9-2-3-11-5-7(10)6(8)4-9/h6-7,10H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | DTSBCTHRZJFIRL-RNFRBKRXSA-N |
| XLogP | -0.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol?
The IUPAC name of (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol (CID 122548054) is (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol.
What is the SMILES notation for (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol?
The canonical SMILES for (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol is CN1CCOC[C@@H](O)[C@H](F)C1.
What is the InChIKey of (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol?
The InChIKey is DTSBCTHRZJFIRL-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H14FNO2/c1-9-2-3-11-5-7(10)6(8)4-9/h6-7,10H,2-5H2,1H3/t6-,7-/m1/s1.
What are the key properties of (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol?
(6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol has a molecular weight of 163.19 g/mol, XLogP of -0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7R)-6-fluoro-4-methyl-1,4-oxazocan-7-ol is sourced from PubChem (CID 122548054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).