C14H24O5 — CID 122548095
(2R,4S,5E,7S)-7-(methoxymethoxy)-4-(methoxymethyl)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 122548095) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R,4S,5E,7S)-7-(methoxymethoxy)-4-(methoxymethyl)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,4S,5E,7S)-7-(methoxymethoxy)-4-(methoxymethyl)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 122548095 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2R,4S,5E,7S)-7-(methoxymethoxy)-4-(methoxymethyl)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | COCO[C@@H]1/C=C/[C@@H](COC)C[C@@H](C)OC(=O)CC1 |
| InChI | InChI=1S/C14H24O5/c1-11-8-12(9-16-2)4-5-13(18-10-17-3)6-7-14(15)19-11/h4-5,11-13H,6-10H2,1-3H3/b5-4+/t11-,12-,13-/m1/s1 |
| InChIKey | MCTMQDGCMWISDQ-GDNMSKEOSA-N |
| XLogP | 1.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|