C18H28O10 — CID 122548443
[(3S,5S,6S)-3,4,5-triacetyloxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]methyl acetate (PubChem CID 122548443) has the molecular formula C18H28O10 and a molecular weight of 404.41 g/mol. Its IUPAC name is [(3S,5S,6S)-3,4,5-triacetyloxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,5S,6S)-3,4,5-triacetyloxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122548443 |
| Molecular Formula | C18H28O10 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(3S,5S,6S)-3,4,5-triacetyloxy-6-[(2-methylpropan-2-yl)oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC(C)(C)C)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H28O10/c1-9(19)23-8-13-14(24-10(2)20)15(25-11(3)21)16(26-12(4)22)17(27-13)28-18(5,6)7/h13-17H,8H2,1-7H3/t13?,14-,15?,16-,17-/m0/s1 |
| InChIKey | XAQFMMJQMZESRB-LZYVMWMOSA-N |
| XLogP | 0.88 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|