C19H12F2O2 — CID 122549194
[3,5-bis(4-fluorophenyl)phenyl] formate (PubChem CID 122549194) has the molecular formula C19H12F2O2 and a molecular weight of 310.30 g/mol. Its IUPAC name is [3,5-bis(4-fluorophenyl)phenyl] formate.
| Compound Name | [3,5-bis(4-fluorophenyl)phenyl] formate |
|---|---|
| PubChem CID | 122549194 |
| Molecular Formula | C19H12F2O2 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | [3,5-bis(4-fluorophenyl)phenyl] formate |
| SMILES | O=COc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H12F2O2/c20-17-5-1-13(2-6-17)15-9-16(11-19(10-15)23-12-22)14-3-7-18(21)8-4-14/h1-12H |
| InChIKey | FIVDLBLWBCYDIN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|